C26H15F6N3O — CID 140639355
N-[5-(4-fluorophenyl)-3-[(E)-2-phenylethenyl]pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 140639355) has the molecular formula C26H15F6N3O and a molecular weight of 499.41 g/mol. Its IUPAC name is N-[5-(4-fluorophenyl)-3-[(E)-2-phenylethenyl]pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[5-(4-fluorophenyl)-3-[(E)-2-phenylethenyl]pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 140639355 |
| Molecular Formula | C26H15F6N3O |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | N-[5-(4-fluorophenyl)-3-[(E)-2-phenylethenyl]pyrazin-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1ncc(-c2ccc(F)cc2)nc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H15F6N3O/c27-16-9-7-15(8-10-16)19-13-33-26(18(34-19)11-6-14-4-2-1-3-5-14)35-20(36)12-17-21(28)23(30)25(32)24(31)22(17)29/h1-11,13H,12H2,(H,33,35,36)/b11-6+ |
| InChIKey | XOHPAIWLHKTXGW-IZZDOVSWSA-N |
| XLogP | 6.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|