C26H21N3O2 — CID 123669034
N-[5-[4-(hydroxymethyl)phenyl]-3-(2-phenylethenyl)pyrazin-2-yl]benzamide (PubChem CID 123669034) has the molecular formula C26H21N3O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[5-[4-(hydroxymethyl)phenyl]-3-(2-phenylethenyl)pyrazin-2-yl]benzamide.
| Compound Name | N-[5-[4-(hydroxymethyl)phenyl]-3-(2-phenylethenyl)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 123669034 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[5-[4-(hydroxymethyl)phenyl]-3-(2-phenylethenyl)pyrazin-2-yl]benzamide |
| SMILES | O=C(Nc1ncc(-c2ccc(CO)cc2)nc1C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21N3O2/c30-18-20-11-14-21(15-12-20)24-17-27-25(29-26(31)22-9-5-2-6-10-22)23(28-24)16-13-19-7-3-1-4-8-19/h1-17,30H,18H2,(H,27,29,31) |
| InChIKey | OYOKEILACKVOCH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |