C26H21N3O3 — CID 135980268
2-(4-hydroxyphenyl)-N-[5-(4-hydroxyphenyl)-3-[(E)-2-phenylethenyl]pyrazin-2-yl]acetamide (PubChem CID 135980268) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-N-[5-(4-hydroxyphenyl)-3-[(E)-2-phenylethenyl]pyrazin-2-yl]acetamide.
| Compound Name | 2-(4-hydroxyphenyl)-N-[5-(4-hydroxyphenyl)-3-[(E)-2-phenylethenyl]pyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 135980268 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-(4-hydroxyphenyl)-N-[5-(4-hydroxyphenyl)-3-[(E)-2-phenylethenyl]pyrazin-2-yl]acetamide |
| SMILES | O=C(Cc1ccc(O)cc1)Nc1ncc(-c2ccc(O)cc2)nc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H21N3O3/c30-21-11-6-19(7-12-21)16-25(32)29-26-23(15-8-18-4-2-1-3-5-18)28-24(17-27-26)20-9-13-22(31)14-10-20/h1-15,17,30-31H,16H2,(H,27,29,32)/b15-8+ |
| InChIKey | DRRPQWXSZBHVCF-OVCLIPMQSA-N |
| XLogP | 4.91 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |