C20H17FIN3O — CID 70830199
N-[3-ethyl-5-(4-fluorophenyl)pyrazin-2-yl]-2-(4-iodophenyl)acetamide (PubChem CID 70830199) has the molecular formula C20H17FIN3O and a molecular weight of 461.28 g/mol. Its IUPAC name is N-[3-ethyl-5-(4-fluorophenyl)pyrazin-2-yl]-2-(4-iodophenyl)acetamide.
| Compound Name | N-[3-ethyl-5-(4-fluorophenyl)pyrazin-2-yl]-2-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 70830199 |
| Molecular Formula | C20H17FIN3O |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N-[3-ethyl-5-(4-fluorophenyl)pyrazin-2-yl]-2-(4-iodophenyl)acetamide |
| SMILES | CCc1nc(-c2ccc(F)cc2)cnc1NC(=O)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C20H17FIN3O/c1-2-17-20(25-19(26)11-13-3-9-16(22)10-4-13)23-12-18(24-17)14-5-7-15(21)8-6-14/h3-10,12H,2,11H2,1H3,(H,23,25,26) |
| InChIKey | UYVQDGDOTFLOOB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|