C22H24N3O2P — CID 143000180
2-(4-hydroxyphenyl)-N-[3-(2-methylpropyl)-5-(4-phosphanylphenyl)pyrazin-2-yl]acetamide (PubChem CID 143000180) has the molecular formula C22H24N3O2P and a molecular weight of 393.43 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-N-[3-(2-methylpropyl)-5-(4-phosphanylphenyl)pyrazin-2-yl]acetamide.
| Compound Name | 2-(4-hydroxyphenyl)-N-[3-(2-methylpropyl)-5-(4-phosphanylphenyl)pyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 143000180 |
| Molecular Formula | C22H24N3O2P |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-(4-hydroxyphenyl)-N-[3-(2-methylpropyl)-5-(4-phosphanylphenyl)pyrazin-2-yl]acetamide |
| SMILES | CC(C)Cc1nc(-c2ccc(P)cc2)cnc1NC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C22H24N3O2P/c1-14(2)11-19-22(25-21(27)12-15-3-7-17(26)8-4-15)23-13-20(24-19)16-5-9-18(28)10-6-16/h3-10,13-14,26H,11-12,28H2,1-2H3,(H,23,25,27) |
| InChIKey | BRMTZRMPPANFGF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|