C23H18FN3O2S — CID 123393100
2-(4-fluorophenyl)-N-[5-[4-(hydroxymethyl)phenyl]-3-thiophen-2-ylpyrazin-2-yl]acetamide (PubChem CID 123393100) has the molecular formula C23H18FN3O2S and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[5-[4-(hydroxymethyl)phenyl]-3-thiophen-2-ylpyrazin-2-yl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[5-[4-(hydroxymethyl)phenyl]-3-thiophen-2-ylpyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 123393100 |
| Molecular Formula | C23H18FN3O2S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[5-[4-(hydroxymethyl)phenyl]-3-thiophen-2-ylpyrazin-2-yl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1ncc(-c2ccc(CO)cc2)nc1-c1cccs1 |
| InChI | InChI=1S/C23H18FN3O2S/c24-18-9-5-15(6-10-18)12-21(29)27-23-22(20-2-1-11-30-20)26-19(13-25-23)17-7-3-16(14-28)4-8-17/h1-11,13,28H,12,14H2,(H,25,27,29) |
| InChIKey | ZDYQZYROCHGPNP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |