C27H21FN6O2 — CID 143000252
4-[5-[[2-(4-fluorophenyl)acetyl]amino]-6-(2-phenylethyl)pyrazin-2-yl]benzoyl azide (PubChem CID 143000252) has the molecular formula C27H21FN6O2 and a molecular weight of 480.50 g/mol. Its IUPAC name is 4-[5-[[2-(4-fluorophenyl)acetyl]amino]-6-(2-phenylethyl)pyrazin-2-yl]benzoyl azide.
| Compound Name | 4-[5-[[2-(4-fluorophenyl)acetyl]amino]-6-(2-phenylethyl)pyrazin-2-yl]benzoyl azide |
|---|---|
| PubChem CID | 143000252 |
| Molecular Formula | C27H21FN6O2 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 4-[5-[[2-(4-fluorophenyl)acetyl]amino]-6-(2-phenylethyl)pyrazin-2-yl]benzoyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1ccc(-c2cnc(NC(=O)Cc3ccc(F)cc3)c(CCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C27H21FN6O2/c28-22-13-6-19(7-14-22)16-25(35)32-26-23(15-8-18-4-2-1-3-5-18)31-24(17-30-26)20-9-11-21(12-10-20)27(36)33-34-29/h1-7,9-14,17H,8,15-16H2,(H,30,32,35) |
| InChIKey | IKGFSAPZTVLROZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|