C29H27F4N3O2 — CID 143000722
N-[3-benzyl-5-(4-hydroxyphenyl)-6-methylpyrazin-2-yl]-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide;ethane (PubChem CID 143000722) has the molecular formula C29H27F4N3O2 and a molecular weight of 525.55 g/mol. Its IUPAC name is N-[3-benzyl-5-(4-hydroxyphenyl)-6-methylpyrazin-2-yl]-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide;ethane.
| Compound Name | N-[3-benzyl-5-(4-hydroxyphenyl)-6-methylpyrazin-2-yl]-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide;ethane |
|---|---|
| PubChem CID | 143000722 |
| Molecular Formula | C29H27F4N3O2 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | N-[3-benzyl-5-(4-hydroxyphenyl)-6-methylpyrazin-2-yl]-2-(2,3,4,5-tetrafluoro-6-methylphenyl)acetamide;ethane |
| SMILES | CC.Cc1nc(NC(=O)Cc2c(C)c(F)c(F)c(F)c2F)c(Cc2ccccc2)nc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C27H21F4N3O2.C2H6/c1-14-19(23(29)25(31)24(30)22(14)28)13-21(36)34-27-20(12-16-6-4-3-5-7-16)33-26(15(2)32-27)17-8-10-18(35)11-9-17;1-2/h3-11,35H,12-13H2,1-2H3,(H,32,34,36);1-2H3 |
| InChIKey | HPQQSSFNJOGVMY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|