C27H23N3O2 — CID 140639333
N-(3-benzyl-7-hydroxy-9H-indeno[1,2-b]pyrazin-2-yl)-3-phenylpropanamide (PubChem CID 140639333) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-(3-benzyl-7-hydroxy-9H-indeno[1,2-b]pyrazin-2-yl)-3-phenylpropanamide.
| Compound Name | N-(3-benzyl-7-hydroxy-9H-indeno[1,2-b]pyrazin-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 140639333 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-(3-benzyl-7-hydroxy-9H-indeno[1,2-b]pyrazin-2-yl)-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1nc2c(nc1Cc1ccccc1)-c1ccc(O)cc1C2 |
| InChI | InChI=1S/C27H23N3O2/c31-21-12-13-22-20(16-21)17-23-26(22)28-24(15-19-9-5-2-6-10-19)27(29-23)30-25(32)14-11-18-7-3-1-4-8-18/h1-10,12-13,16,31H,11,14-15,17H2,(H,29,30,32) |
| InChIKey | GTYNBILKWXKAOJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |