About 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol
3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol (PubChem CID 163734730) has the molecular formula C27H25N3O2
and a molecular weight of 423.52 g/mol. Its IUPAC name is 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol.
Molecular Properties
| Compound Name | 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol |
| PubChem CID | 163734730 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol |
| SMILES | Oc1ccc2c(c1)Cc1nc(NC(O)CCc3ccccc3)c(Cc3ccccc3)nc1-2 |
| InChI | InChI=1S/C27H25N3O2/c31-21-12-13-22-20(16-21)17-23-26(22)28-24(15-19-9-5-2-6-10-19)27(29-23)30-25(32)14-11-18-7-3-1-4-8-18/h1-10,12-13,16,25,31-32H,11,14-15,17H2,(H,29,30) |
| InChIKey | LCPFKOLVYCDVFF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol?
The IUPAC name of 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol (CID 163734730) is 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol.
What is the SMILES notation for 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol?
The canonical SMILES for 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol is Oc1ccc2c(c1)Cc1nc(NC(O)CCc3ccccc3)c(Cc3ccccc3)nc1-2.
What is the InChIKey of 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol?
The InChIKey is LCPFKOLVYCDVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25N3O2/c31-21-12-13-22-20(16-21)17-23-26(22)28-24(15-19-9-5-2-6-10-19)27(29-23)30-25(32)14-11-18-7-3-1-4-8-18/h1-10,12-13,16,25,31-32H,11,14-15,17H2,(H,29,30).
What are the key properties of 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol?
3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol has a molecular weight of 423.52 g/mol, XLogP of 4.71, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-[(1-hydroxy-3-phenylpropyl)amino]-9H-indeno[1,2-b]pyrazin-7-ol is sourced from PubChem (CID 163734730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).