C19H13F5N2O2S — CID 24524482
N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 24524482) has the molecular formula C19H13F5N2O2S and a molecular weight of 428.38 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 24524482 |
| Molecular Formula | C19H13F5N2O2S |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | COc1ccc(-c2nc(NC(=O)Cc3c(F)c(F)c(F)c(F)c3F)sc2C)cc1 |
| InChI | InChI=1S/C19H13F5N2O2S/c1-8-18(9-3-5-10(28-2)6-4-9)26-19(29-8)25-12(27)7-11-13(20)15(22)17(24)16(23)14(11)21/h3-6H,7H2,1-2H3,(H,25,26,27) |
| InChIKey | JONZGLAACYSPEX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|