C20H13F5N2O3S — CID 16575050
ethyl 2-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 16575050) has the molecular formula C20H13F5N2O3S and a molecular weight of 456.39 g/mol. Its IUPAC name is ethyl 2-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 16575050 |
| Molecular Formula | C20H13F5N2O3S |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | ethyl 2-[[2-(2,3,4,5,6-pentafluorophenyl)acetyl]amino]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)Cc2c(F)c(F)c(F)c(F)c2F)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H13F5N2O3S/c1-2-30-19(29)18-17(9-6-4-3-5-7-9)27-20(31-18)26-11(28)8-10-12(21)14(23)16(25)15(24)13(10)22/h3-7H,2,8H2,1H3,(H,26,27,28) |
| InChIKey | SOZHNAWHLKVCDT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|