C18H26ClN3O2S — CID 119677240
7-amino-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]heptanamide;hydrochloride (PubChem CID 119677240) has the molecular formula C18H26ClN3O2S and a molecular weight of 383.95 g/mol. Its IUPAC name is 7-amino-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119677240 |
| Molecular Formula | C18H26ClN3O2S |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 7-amino-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]heptanamide;hydrochloride |
| SMILES | COc1ccc(-c2nc(NC(=O)CCCCCCN)sc2C)cc1.Cl |
| InChI | InChI=1S/C18H25N3O2S.ClH/c1-13-17(14-8-10-15(23-2)11-9-14)21-18(24-13)20-16(22)7-5-3-4-6-12-19;/h8-11H,3-7,12,19H2,1-2H3,(H,20,21,22);1H |
| InChIKey | HTYQWPCLQFERAU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|