C17H24N4O2S2 — CID 143593087
6-(aminosulfanylamino)-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]hexanamide (PubChem CID 143593087) has the molecular formula C17H24N4O2S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 6-(aminosulfanylamino)-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]hexanamide.
| Compound Name | 6-(aminosulfanylamino)-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 143593087 |
| Molecular Formula | C17H24N4O2S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 6-(aminosulfanylamino)-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]hexanamide |
| SMILES | COc1ccc(-c2nc(NC(=O)CCCCCNSN)sc2C)cc1 |
| InChI | InChI=1S/C17H24N4O2S2/c1-12-16(13-7-9-14(23-2)10-8-13)21-17(24-12)20-15(22)6-4-3-5-11-19-25-18/h7-10,19H,3-6,11,18H2,1-2H3,(H,20,21,22) |
| InChIKey | LWDXRVGDWTXFNR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|