C22H16F5N3O — CID 123608733
N-(2-ethyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 123608733) has the molecular formula C22H16F5N3O and a molecular weight of 433.38 g/mol. Its IUPAC name is N-(2-ethyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-(2-ethyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 123608733 |
| Molecular Formula | C22H16F5N3O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-(2-ethyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | CCc1nc2c(nc1NC(=O)Cc1c(F)c(F)c(F)c(F)c1F)CCc1ccccc1-2 |
| InChI | InChI=1S/C22H16F5N3O/c1-2-13-22(29-14-8-7-10-5-3-4-6-11(10)21(14)28-13)30-15(31)9-12-16(23)18(25)20(27)19(26)17(12)24/h3-6H,2,7-9H2,1H3,(H,29,30,31) |
| InChIKey | CEXLTOPSBNTHJI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|