C21H13F6N3O — CID 123368208
N-(8-fluoro-2-methyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 123368208) has the molecular formula C21H13F6N3O and a molecular weight of 437.34 g/mol. Its IUPAC name is N-(8-fluoro-2-methyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-(8-fluoro-2-methyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 123368208 |
| Molecular Formula | C21H13F6N3O |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-(8-fluoro-2-methyl-5,6-dihydrobenzo[f]quinoxalin-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | Cc1nc2c(nc1NC(=O)Cc1c(F)c(F)c(F)c(F)c1F)CCc1cc(F)ccc1-2 |
| InChI | InChI=1S/C21H13F6N3O/c1-8-21(29-13-5-2-9-6-10(22)3-4-11(9)20(13)28-8)30-14(31)7-12-15(23)17(25)19(27)18(26)16(12)24/h3-4,6H,2,5,7H2,1H3,(H,29,30,31) |
| InChIKey | LVURJEZPLXCIGQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|