C35H37N3O2Si — CID 58455817
2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-N-[5-(4-methylphenyl)-3-naphthalen-1-ylpyrazin-2-yl]acetamide (PubChem CID 58455817) has the molecular formula C35H37N3O2Si and a molecular weight of 559.79 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-N-[5-(4-methylphenyl)-3-naphthalen-1-ylpyrazin-2-yl]acetamide.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-N-[5-(4-methylphenyl)-3-naphthalen-1-ylpyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 58455817 |
| Molecular Formula | C35H37N3O2Si |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-N-[5-(4-methylphenyl)-3-naphthalen-1-ylpyrazin-2-yl]acetamide |
| SMILES | Cc1ccc(-c2cnc(NC(=O)Cc3ccc(O[Si](C)(C)C(C)(C)C)cc3)c(-c3cccc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C35H37N3O2Si/c1-24-14-18-27(19-15-24)31-23-36-34(33(37-31)30-13-9-11-26-10-7-8-12-29(26)30)38-32(39)22-25-16-20-28(21-17-25)40-41(5,6)35(2,3)4/h7-21,23H,22H2,1-6H3,(H,36,38,39) |
| InChIKey | KFNIKYRRMJUWJK-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|