C26H29N3OSi — CID 67432963
5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-naphthalen-2-ylpyrazin-2-amine (PubChem CID 67432963) has the molecular formula C26H29N3OSi and a molecular weight of 427.62 g/mol. Its IUPAC name is 5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-naphthalen-2-ylpyrazin-2-amine.
| Compound Name | 5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-naphthalen-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 67432963 |
| Molecular Formula | C26H29N3OSi |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 5-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-naphthalen-2-ylpyrazin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2cnc(N)c(-c3ccc4ccccc4c3)n2)cc1 |
| InChI | InChI=1S/C26H29N3OSi/c1-26(2,3)31(4,5)30-22-14-12-19(13-15-22)23-17-28-25(27)24(29-23)21-11-10-18-8-6-7-9-20(18)16-21/h6-17H,1-5H3,(H2,27,28) |
| InChIKey | YMKZFJSADLFXDS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|