C19H19N3O3 — CID 142945202
3-(3,4-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrazin-2-amine (PubChem CID 142945202) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrazin-2-amine.
| Compound Name | 3-(3,4-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 142945202 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrazin-2-amine |
| SMILES | COc1ccc(-c2cnc(N)c(-c3ccc(OC)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-23-14-7-4-12(5-8-14)15-11-21-19(20)18(22-15)13-6-9-16(24-2)17(10-13)25-3/h4-11H,1-3H3,(H2,20,21) |
| InChIKey | IFCFCAZNVLENBC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |