C17H16N2O — CID 102082916
2-(4-methoxyphenyl)-6,7-dimethylquinoxaline (PubChem CID 102082916) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6,7-dimethylquinoxaline.
| Compound Name | 2-(4-methoxyphenyl)-6,7-dimethylquinoxaline |
|---|---|
| PubChem CID | 102082916 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-6,7-dimethylquinoxaline |
| SMILES | COc1ccc(-c2cnc3cc(C)c(C)cc3n2)cc1 |
| InChI | InChI=1S/C17H16N2O/c1-11-8-15-16(9-12(11)2)19-17(10-18-15)13-4-6-14(20-3)7-5-13/h4-10H,1-3H3 |
| InChIKey | WFEXEAMQHGTDIL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |