C19H24N2 — CID 155245671
2-ethyl-4,5-bis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-imidazole (PubChem CID 155245671) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-ethyl-4,5-bis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-imidazole.
| Compound Name | 2-ethyl-4,5-bis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-imidazole |
|---|---|
| PubChem CID | 155245671 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-ethyl-4,5-bis[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-imidazole |
| SMILES | C=C/C=C(\C=C/C)c1nc(CC)[nH]c1C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C19H24N2/c1-6-11-15(12-7-2)18-19(21-17(10-5)20-18)16(13-8-3)14-9-4/h6-9,11-14H,1,3,10H2,2,4-5H3,(H,20,21)/b12-7-,14-9-,15-11+,16-13+ |
| InChIKey | KFMKQIGEFSXMHJ-FGMVZJFCSA-N |
| XLogP | 5.26 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|