C22H23N3 — CID 143135789
6-ethyl-2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]-1H-indole (PubChem CID 143135789) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 6-ethyl-2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]-1H-indole.
| Compound Name | 6-ethyl-2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]-1H-indole |
|---|---|
| PubChem CID | 143135789 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 6-ethyl-2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]-1H-indole |
| SMILES | C=C/C=C(\C=C/C)C1=NNC(=C)C(c2cc3ccc(CC)cc3[nH]2)=C1 |
| InChI | InChI=1S/C22H23N3/c1-5-8-17(9-6-2)21-14-19(15(4)24-25-21)22-13-18-11-10-16(7-3)12-20(18)23-22/h5-6,8-14,23-24H,1,4,7H2,2-3H3/b9-6-,17-8+ |
| InChIKey | IUCZZEKRNXBYOG-CWQCYKQBSA-N |
| XLogP | 5.28 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|