C26H23N3 — CID 144664691
4-[5-[3-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrrol-2-yl]phenyl]-1H-pyrrol-2-yl]pyridine (PubChem CID 144664691) has the molecular formula C26H23N3 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[5-[3-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrrol-2-yl]phenyl]-1H-pyrrol-2-yl]pyridine.
| Compound Name | 4-[5-[3-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrrol-2-yl]phenyl]-1H-pyrrol-2-yl]pyridine |
|---|---|
| PubChem CID | 144664691 |
| Molecular Formula | C26H23N3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 4-[5-[3-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyrrol-2-yl]phenyl]-1H-pyrrol-2-yl]pyridine |
| SMILES | C=C/C=C(\C=C/C)c1ccc(-c2cccc(-c3ccc(-c4ccncc4)[nH]3)c2)[nH]1 |
| InChI | InChI=1S/C26H23N3/c1-3-6-19(7-4-2)23-10-12-25(28-23)21-8-5-9-22(18-21)26-13-11-24(29-26)20-14-16-27-17-15-20/h3-18,28-29H,1H2,2H3/b7-4-,19-6+ |
| InChIKey | CGBDBCNDFGWAAY-CQKLJWTNSA-N |
| XLogP | 6.88 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|