C28H26N4 — CID 174148997
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3H-benzimidazol-5-yl]-1H-benzimidazole (PubChem CID 174148997) has the molecular formula C28H26N4 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3H-benzimidazol-5-yl]-1H-benzimidazole.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3H-benzimidazol-5-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 174148997 |
| Molecular Formula | C28H26N4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3H-benzimidazol-5-yl]-1H-benzimidazole |
| SMILES | C=C/C=C(\C=C/C)c1nc2ccc(-c3ccc4nc(C(/C=C\C)=C/C=C)[nH]c4c3)cc2[nH]1 |
| InChI | InChI=1S/C28H26N4/c1-5-9-19(10-6-2)27-29-23-15-13-21(17-25(23)31-27)22-14-16-24-26(18-22)32-28(30-24)20(11-7-3)12-8-4/h5-18H,1,3H2,2,4H3,(H,29,31)(H,30,32)/b10-6-,12-8-,19-9+,20-11+ |
| InChIKey | AMARTSQKRUZWRQ-DWNJYWBNSA-N |
| XLogP | 7.40 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|