C26H29N5O4 — CID 142034895
2-[[2-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-3H-benzimidazole-5-carbonyl]amino]-3-anilinopropanoic acid;propan-2-one (PubChem CID 142034895) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[[2-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-3H-benzimidazole-5-carbonyl]amino]-3-anilinopropanoic acid;propan-2-one.
| Compound Name | 2-[[2-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-3H-benzimidazole-5-carbonyl]amino]-3-anilinopropanoic acid;propan-2-one |
|---|---|
| PubChem CID | 142034895 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 2-[[2-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-3H-benzimidazole-5-carbonyl]amino]-3-anilinopropanoic acid;propan-2-one |
| SMILES | C=C/C=C(\C=C/N)c1nc2ccc(C(=O)NC(CNc3ccccc3)C(=O)O)cc2[nH]1.CC(C)=O |
| InChI | InChI=1S/C23H23N5O3.C3H6O/c1-2-6-15(11-12-24)21-26-18-10-9-16(13-19(18)27-21)22(29)28-20(23(30)31)14-25-17-7-4-3-5-8-17;1-3(2)4/h2-13,20,25H,1,14,24H2,(H,26,27)(H,28,29)(H,30,31);1-2H3/b12-11-,15-6+; |
| InChIKey | MQHQVNUHHJLFMS-RXFOZGCTSA-N |
| XLogP | 3.50 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|