C22H19F2N3 — CID 144501057
6-(2,4-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-methylquinazolin-4-amine (PubChem CID 144501057) has the molecular formula C22H19F2N3 and a molecular weight of 363.41 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-methylquinazolin-4-amine.
| Compound Name | 6-(2,4-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 144501057 |
| Molecular Formula | C22H19F2N3 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 6-(2,4-difluorophenyl)-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-methylquinazolin-4-amine |
| SMILES | C=C/C=C(\C=C/C)c1nc(NC)c2cc(-c3ccc(F)cc3F)ccc2n1 |
| InChI | InChI=1S/C22H19F2N3/c1-4-6-14(7-5-2)21-26-20-11-8-15(12-18(20)22(25-3)27-21)17-10-9-16(23)13-19(17)24/h4-13H,1H2,2-3H3,(H,25,26,27)/b7-5-,14-6+ |
| InChIKey | MNTHZGMJJRGVOQ-CYMBIFCZSA-N |
| XLogP | 5.76 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|