C22H30N2 — CID 144729943
ethane;6-ethyl-2-[(2E,4E,6Z)-7-ethylnona-2,4,6,8-tetraen-4-yl]-1H-benzimidazole (PubChem CID 144729943) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is ethane;6-ethyl-2-[(2E,4E,6Z)-7-ethylnona-2,4,6,8-tetraen-4-yl]-1H-benzimidazole.
| Compound Name | ethane;6-ethyl-2-[(2E,4E,6Z)-7-ethylnona-2,4,6,8-tetraen-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 144729943 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | ethane;6-ethyl-2-[(2E,4E,6Z)-7-ethylnona-2,4,6,8-tetraen-4-yl]-1H-benzimidazole |
| SMILES | C=C/C(=C\C=C(/C=C/C)c1nc2ccc(CC)cc2[nH]1)CC.CC |
| InChI | InChI=1S/C20H24N2.C2H6/c1-5-9-17(12-10-15(6-2)7-3)20-21-18-13-11-16(8-4)14-19(18)22-20;1-2/h5-6,9-14H,2,7-8H2,1,3-4H3,(H,21,22);1-2H3/b9-5+,15-10+,17-12+; |
| InChIKey | WTLPSFOLZHHCQV-ADSRRBBASA-N |
| XLogP | 6.63 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|