C17H18N2OS — CID 143576012
[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenyl-1,3-oxazol-2-yl]sulfanylmethanamine (PubChem CID 143576012) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenyl-1,3-oxazol-2-yl]sulfanylmethanamine.
| Compound Name | [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenyl-1,3-oxazol-2-yl]sulfanylmethanamine |
|---|---|
| PubChem CID | 143576012 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenyl-1,3-oxazol-2-yl]sulfanylmethanamine |
| SMILES | C=C/C=C(\C=C/C)c1nc(SCN)oc1-c1ccccc1 |
| InChI | InChI=1S/C17H18N2OS/c1-3-8-13(9-4-2)15-16(14-10-6-5-7-11-14)20-17(19-15)21-12-18/h3-11H,1,12,18H2,2H3/b9-4-,13-8+ |
| InChIKey | LIZOGURYXJDTCY-NTHABNPXSA-N |
| XLogP | 4.50 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|