C25H21N3 — CID 138665431
3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-naphthalen-1-yl-5-phenyl-1,2,4-triazole (PubChem CID 138665431) has the molecular formula C25H21N3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-naphthalen-1-yl-5-phenyl-1,2,4-triazole.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-naphthalen-1-yl-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 138665431 |
| Molecular Formula | C25H21N3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-naphthalen-1-yl-5-phenyl-1,2,4-triazole |
| SMILES | C=C/C=C(\C=C/C)c1nnc(-c2ccccc2)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C25H21N3/c1-3-11-20(12-4-2)24-26-27-25(21-14-6-5-7-15-21)28(24)23-18-10-16-19-13-8-9-17-22(19)23/h3-18H,1H2,2H3/b12-4-,20-11+ |
| InChIKey | SEHNZYIWGJWYMZ-HDTOOCABSA-N |
| XLogP | 6.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|