C27H26N2 — CID 143300997
ethane;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-(3-methylphenyl)benzo[f]phthalazine (PubChem CID 143300997) has the molecular formula C27H26N2 and a molecular weight of 378.52 g/mol. Its IUPAC name is ethane;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-(3-methylphenyl)benzo[f]phthalazine.
| Compound Name | ethane;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-(3-methylphenyl)benzo[f]phthalazine |
|---|---|
| PubChem CID | 143300997 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | ethane;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-(3-methylphenyl)benzo[f]phthalazine |
| SMILES | C=C/C=C(\C=C)c1nnc(-c2cccc(C)c2)c2ccc3ccccc3c12.CC |
| InChI | InChI=1S/C25H20N2.C2H6/c1-4-9-18(5-2)25-23-21-13-7-6-11-19(21)14-15-22(23)24(26-27-25)20-12-8-10-17(3)16-20;1-2/h4-16H,1-2H2,3H3;1-2H3/b18-9+; |
| InChIKey | SSBJIAJNRFCYMK-WUBZALIBSA-N |
| XLogP | 7.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|