C44H33N3 — CID 166956957
13-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-isoquinolin-1-yl-7,14-dimethyl-6-phenylquinolino[4,3-j]phenanthridine (PubChem CID 166956957) has the molecular formula C44H33N3 and a molecular weight of 603.77 g/mol. Its IUPAC name is 13-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-isoquinolin-1-yl-7,14-dimethyl-6-phenylquinolino[4,3-j]phenanthridine.
| Compound Name | 13-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-isoquinolin-1-yl-7,14-dimethyl-6-phenylquinolino[4,3-j]phenanthridine |
|---|---|
| PubChem CID | 166956957 |
| Molecular Formula | C44H33N3 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 13-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-isoquinolin-1-yl-7,14-dimethyl-6-phenylquinolino[4,3-j]phenanthridine |
| SMILES | C=C/C=C(\C=C/C)c1nc2ccccc2c2c(C)c3c(-c4ccccc4)nc4cc(-c5nccc6ccccc56)ccc4c3c(C)c12 |
| InChI | InChI=1S/C44H33N3/c1-5-14-30(15-6-2)43-40-28(4)39-35-23-22-32(42-33-19-11-10-16-29(33)24-25-45-42)26-37(35)47-44(31-17-8-7-9-18-31)41(39)27(3)38(40)34-20-12-13-21-36(34)46-43/h5-26H,1H2,2-4H3/b15-6-,30-14+ |
| InChIKey | JSERFAJAEKYHIB-WZPAVONZSA-N |
| XLogP | 11.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|