C45H38N2 — CID 166956863
6-[(2E,4Z)-hexa-2,4-dien-3-yl]-8-(4-isoquinolin-1-yl-2-methylphenyl)-7,10-dimethyl-9-(1-phenylethenyl)phenanthridine (PubChem CID 166956863) has the molecular formula C45H38N2 and a molecular weight of 606.81 g/mol. Its IUPAC name is 6-[(2E,4Z)-hexa-2,4-dien-3-yl]-8-(4-isoquinolin-1-yl-2-methylphenyl)-7,10-dimethyl-9-(1-phenylethenyl)phenanthridine.
| Compound Name | 6-[(2E,4Z)-hexa-2,4-dien-3-yl]-8-(4-isoquinolin-1-yl-2-methylphenyl)-7,10-dimethyl-9-(1-phenylethenyl)phenanthridine |
|---|---|
| PubChem CID | 166956863 |
| Molecular Formula | C45H38N2 |
| Molecular Weight | 606.81 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 6-[(2E,4Z)-hexa-2,4-dien-3-yl]-8-(4-isoquinolin-1-yl-2-methylphenyl)-7,10-dimethyl-9-(1-phenylethenyl)phenanthridine |
| SMILES | C=C(c1ccccc1)c1c(-c2ccc(-c3nccc4ccccc34)cc2C)c(C)c2c(C(/C=C\C)=C/C)nc3ccccc3c2c1C |
| InChI | InChI=1S/C45H38N2/c1-7-16-32(8-2)45-43-31(6)41(36-24-23-35(27-28(36)3)44-37-20-13-12-19-34(37)25-26-46-44)40(29(4)33-17-10-9-11-18-33)30(5)42(43)38-21-14-15-22-39(38)47-45/h7-27H,4H2,1-3,5-6H3/b16-7-,32-8+ |
| InChIKey | WRKRCRLCBFYXJV-BWYUXCJQSA-N |
| XLogP | 12.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.81 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|