C48H34N2 — CID 137418785
2-[4-(7,10-diphenylfluoranthen-8-yl)phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]quinazoline (PubChem CID 137418785) has the molecular formula C48H34N2 and a molecular weight of 638.81 g/mol. Its IUPAC name is 2-[4-(7,10-diphenylfluoranthen-8-yl)phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]quinazoline.
| Compound Name | 2-[4-(7,10-diphenylfluoranthen-8-yl)phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]quinazoline |
|---|---|
| PubChem CID | 137418785 |
| Molecular Formula | C48H34N2 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | 2-[4-(7,10-diphenylfluoranthen-8-yl)phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]quinazoline |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccc(-c3cc(-c4ccccc4)c4c(c3-c3ccccc3)-c3cccc5cccc-4c35)cc2)nc2ccccc12 |
| InChI | InChI=1S/C48H34N2/c1-3-15-31(4-2)47-37-22-11-12-25-42(37)49-48(50-47)36-28-26-33(27-29-36)40-30-41(32-16-7-5-8-17-32)45-38-23-13-20-34-21-14-24-39(43(34)38)46(45)44(40)35-18-9-6-10-19-35/h3-30H,1-2H3/b15-3-,31-4+ |
| InChIKey | OABQCCZQPMKJBF-YSGXMSJASA-N |
| XLogP | 13.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|