C58H40O2P2 — CID 118028356
8-[3,5-bis(diphenylphosphoryl)phenyl]-7,10-diphenylfluoranthene (PubChem CID 118028356) has the molecular formula C58H40O2P2 and a molecular weight of 830.90 g/mol. Its IUPAC name is 8-[3,5-bis(diphenylphosphoryl)phenyl]-7,10-diphenylfluoranthene.
| Compound Name | 8-[3,5-bis(diphenylphosphoryl)phenyl]-7,10-diphenylfluoranthene |
|---|---|
| PubChem CID | 118028356 |
| Molecular Formula | C58H40O2P2 |
| Molecular Weight | 830.90 g/mol |
| Exact Mass | 830.25 |
| IUPAC Name | 8-[3,5-bis(diphenylphosphoryl)phenyl]-7,10-diphenylfluoranthene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cc(-c2cc(-c3ccccc3)c3c(c2-c2ccccc2)-c2cccc4cccc-3c24)cc(P(=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C58H40O2P2/c59-61(45-27-11-3-12-28-45,46-29-13-4-14-30-46)49-37-44(38-50(39-49)62(60,47-31-15-5-16-32-47)48-33-17-6-18-34-48)54-40-53(41-21-7-1-8-22-41)57-51-35-19-25-42-26-20-36-52(55(42)51)58(57)56(54)43-23-9-2-10-24-43/h1-40H |
| InChIKey | GMFRBWIXEJBBDT-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.90 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|