C67H51N — CID 140595206
1-[3-[3-[2,6-dimethyl-3,5-bis(4-methyl-3,5-diphenylphenyl)phenyl]phenyl]phenyl]isoquinoline (PubChem CID 140595206) has the molecular formula C67H51N and a molecular weight of 870.15 g/mol. Its IUPAC name is 1-[3-[3-[2,6-dimethyl-3,5-bis(4-methyl-3,5-diphenylphenyl)phenyl]phenyl]phenyl]isoquinoline.
| Compound Name | 1-[3-[3-[2,6-dimethyl-3,5-bis(4-methyl-3,5-diphenylphenyl)phenyl]phenyl]phenyl]isoquinoline |
|---|---|
| PubChem CID | 140595206 |
| Molecular Formula | C67H51N |
| Molecular Weight | 870.15 g/mol |
| Exact Mass | 869.40 |
| IUPAC Name | 1-[3-[3-[2,6-dimethyl-3,5-bis(4-methyl-3,5-diphenylphenyl)phenyl]phenyl]phenyl]isoquinoline |
| SMILES | Cc1c(-c2ccccc2)cc(-c2cc(-c3cc(-c4ccccc4)c(C)c(-c4ccccc4)c3)c(C)c(-c3cccc(-c4cccc(-c5nccc6ccccc56)c4)c3)c2C)cc1-c1ccccc1 |
| InChI | InChI=1S/C67H51N/c1-44-60(48-21-9-5-10-22-48)39-57(40-61(44)49-23-11-6-12-24-49)64-43-65(58-41-62(50-25-13-7-14-26-50)45(2)63(42-58)51-27-15-8-16-28-51)47(4)66(46(64)3)55-32-19-30-53(37-55)54-31-20-33-56(38-54)67-59-34-18-17-29-52(59)35-36-68-67/h5-43H,1-4H3 |
| InChIKey | GBFZNYTUEZPMHI-UHFFFAOYSA-N |
| XLogP | 18.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.15 |
| LogP ≤ 5 | 18.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |