C61H41N3 — CID 140786241
1-[3-[4-(3,5-diphenylphenyl)-6-[3-(3,5-diphenylphenyl)phenyl]pyrimidin-2-yl]phenyl]isoquinoline (PubChem CID 140786241) has the molecular formula C61H41N3 and a molecular weight of 816.02 g/mol. Its IUPAC name is 1-[3-[4-(3,5-diphenylphenyl)-6-[3-(3,5-diphenylphenyl)phenyl]pyrimidin-2-yl]phenyl]isoquinoline.
| Compound Name | 1-[3-[4-(3,5-diphenylphenyl)-6-[3-(3,5-diphenylphenyl)phenyl]pyrimidin-2-yl]phenyl]isoquinoline |
|---|---|
| PubChem CID | 140786241 |
| Molecular Formula | C61H41N3 |
| Molecular Weight | 816.02 g/mol |
| Exact Mass | 815.33 |
| IUPAC Name | 1-[3-[4-(3,5-diphenylphenyl)-6-[3-(3,5-diphenylphenyl)phenyl]pyrimidin-2-yl]phenyl]isoquinoline |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4cc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)nc(-c5cccc(-c6nccc7ccccc67)c5)n4)c3)c2)cc1 |
| InChI | InChI=1S/C61H41N3/c1-5-17-42(18-6-1)51-35-52(43-19-7-2-8-20-43)38-55(37-51)47-26-15-27-48(33-47)58-41-59(56-39-53(44-21-9-3-10-22-44)36-54(40-56)45-23-11-4-12-24-45)64-61(63-58)50-29-16-28-49(34-50)60-57-30-14-13-25-46(57)31-32-62-60/h1-41H |
| InChIKey | LJKXSAPTLLEBPQ-UHFFFAOYSA-N |
| XLogP | 16.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.02 |
| LogP ≤ 5 | 16.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |