C21H17N2O2S- — CID 22917034
CID 22917034 (PubChem CID 22917034) has the molecular formula C21H17N2O2S- and a molecular weight of 361.45 g/mol.
| Compound Name | CID 22917034 |
|---|---|
| PubChem CID | 22917034 |
| Molecular Formula | C21H17N2O2S- |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | — |
| SMILES | NS(=O)[O-].c1ccc(-c2cccc(-c3nccc4ccccc34)c2)cc1 |
| InChI | InChI=1S/C21H15N.H3NO2S/c1-2-7-16(8-3-1)18-10-6-11-19(15-18)21-20-12-5-4-9-17(20)13-14-22-21;1-4(2)3/h1-15H;1H2,(H,2,3)/p-1 |
| InChIKey | SRZJDPISNNCZGH-UHFFFAOYSA-M |
| XLogP | 4.31 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|