C45H34N4 — CID 163893350
(1Z,3E)-4-[4-[7,14-dimethyl-6-(4-pyridin-3-ylphenyl)quinolino[4,3-j]phenanthridin-13-yl]phenyl]hexa-1,3,5-trien-1-amine (PubChem CID 163893350) has the molecular formula C45H34N4 and a molecular weight of 630.80 g/mol. Its IUPAC name is (1Z,3E)-4-[4-[7,14-dimethyl-6-(4-pyridin-3-ylphenyl)quinolino[4,3-j]phenanthridin-13-yl]phenyl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-4-[4-[7,14-dimethyl-6-(4-pyridin-3-ylphenyl)quinolino[4,3-j]phenanthridin-13-yl]phenyl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 163893350 |
| Molecular Formula | C45H34N4 |
| Molecular Weight | 630.80 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | (1Z,3E)-4-[4-[7,14-dimethyl-6-(4-pyridin-3-ylphenyl)quinolino[4,3-j]phenanthridin-13-yl]phenyl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(=C\C=C/N)c1ccc(-c2nc3ccccc3c3c(C)c4c(-c5ccc(-c6cccnc6)cc5)nc5ccccc5c4c(C)c23)cc1 |
| InChI | InChI=1S/C45H34N4/c1-4-30(11-9-25-46)31-17-21-33(22-18-31)44-42-28(2)41-37-14-6-8-16-39(37)49-45(34-23-19-32(20-24-34)35-12-10-26-47-27-35)43(41)29(3)40(42)36-13-5-7-15-38(36)48-44/h4-27H,1,46H2,2-3H3/b25-9-,30-11+ |
| InChIKey | QDLUTIWJPFUJNV-DRUCCHDDSA-N |
| XLogP | 11.14 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.80 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|