C50H30N8 — CID 121474688
22-[4-[4,6-bis(5-pyridin-3-yl-2-pyridinyl)-1,3,5-triazin-2-yl]phenyl]-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene (PubChem CID 121474688) has the molecular formula C50H30N8 and a molecular weight of 742.85 g/mol. Its IUPAC name is 22-[4-[4,6-bis(5-pyridin-3-yl-2-pyridinyl)-1,3,5-triazin-2-yl]phenyl]-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene.
| Compound Name | 22-[4-[4,6-bis(5-pyridin-3-yl-2-pyridinyl)-1,3,5-triazin-2-yl]phenyl]-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene |
|---|---|
| PubChem CID | 121474688 |
| Molecular Formula | C50H30N8 |
| Molecular Weight | 742.85 g/mol |
| Exact Mass | 742.26 |
| IUPAC Name | 22-[4-[4,6-bis(5-pyridin-3-yl-2-pyridinyl)-1,3,5-triazin-2-yl]phenyl]-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene |
| SMILES | c1cncc(-c2ccc(-c3nc(-c4ccc(-c5nc6ccccc6c6c7ccccc7c7ccccc7c56)cc4)nc(-c4ccc(-c5cccnc5)cn4)n3)nc2)c1 |
| InChI | InChI=1S/C50H30N8/c1-3-13-39-37(11-1)38-12-2-4-14-40(38)46-45(39)41-15-5-6-16-42(41)55-47(46)31-17-19-32(20-18-31)48-56-49(43-23-21-35(29-53-43)33-9-7-25-51-27-33)58-50(57-48)44-24-22-36(30-54-44)34-10-8-26-52-28-34/h1-30H |
| InChIKey | VZXJRDSZXWNPOV-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.85 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|