C39H25N5 — CID 176818956
6-[5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-pyridinyl]phenanthridine (PubChem CID 176818956) has the molecular formula C39H25N5 and a molecular weight of 563.66 g/mol. Its IUPAC name is 6-[5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-pyridinyl]phenanthridine.
| Compound Name | 6-[5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-pyridinyl]phenanthridine |
|---|---|
| PubChem CID | 176818956 |
| Molecular Formula | C39H25N5 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 6-[5-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-2-pyridinyl]phenanthridine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5nc6ccccc6c6ccccc56)nc4)n3)cc2)cc1 |
| InChI | InChI=1S/C39H25N5/c1-3-11-26(12-4-1)27-19-21-29(22-20-27)38-42-37(28-13-5-2-6-14-28)43-39(44-38)30-23-24-35(40-25-30)36-33-17-8-7-15-31(33)32-16-9-10-18-34(32)41-36/h1-25H |
| InChIKey | BOJLATQJJKWKDT-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|