C38H24N6 — CID 176818985
6-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridinyl]-2-pyridinyl]phenanthridine (PubChem CID 176818985) has the molecular formula C38H24N6 and a molecular weight of 564.65 g/mol. Its IUPAC name is 6-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridinyl]-2-pyridinyl]phenanthridine.
| Compound Name | 6-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridinyl]-2-pyridinyl]phenanthridine |
|---|---|
| PubChem CID | 176818985 |
| Molecular Formula | C38H24N6 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 6-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridinyl]-2-pyridinyl]phenanthridine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4ccnc(-c5nc6ccccc6c6ccccc56)c4)ccn3)n2)cc1 |
| InChI | InChI=1S/C38H24N6/c1-3-11-25(12-4-1)36-42-37(26-13-5-2-6-14-26)44-38(43-36)34-24-28(20-22-40-34)27-19-21-39-33(23-27)35-31-17-8-7-15-29(31)30-16-9-10-18-32(30)41-35/h1-24H |
| InChIKey | PNBFOYUHRSUDJT-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|