C43H27N7 — CID 176819163
6-[6-[2-[4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]-4-pyridinyl]-2-pyridinyl]phenanthridine (PubChem CID 176819163) has the molecular formula C43H27N7 and a molecular weight of 641.74 g/mol. Its IUPAC name is 6-[6-[2-[4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]-4-pyridinyl]-2-pyridinyl]phenanthridine.
| Compound Name | 6-[6-[2-[4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]-4-pyridinyl]-2-pyridinyl]phenanthridine |
|---|---|
| PubChem CID | 176819163 |
| Molecular Formula | C43H27N7 |
| Molecular Weight | 641.74 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | 6-[6-[2-[4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]-4-pyridinyl]-2-pyridinyl]phenanthridine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4cccnc4)cc3)nc(-c3cc(-c4cccc(-c5nc6ccccc6c6ccccc56)n4)ccn3)n2)cc1 |
| InChI | InChI=1S/C43H27N7/c1-2-10-29(11-3-1)41-48-42(30-21-19-28(20-22-30)32-12-9-24-44-27-32)50-43(49-41)39-26-31(23-25-45-39)36-17-8-18-38(46-36)40-35-15-5-4-13-33(35)34-14-6-7-16-37(34)47-40/h1-27H |
| InChIKey | SEIBYPGELVCMCY-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.74 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|