C50H32N6 — CID 176818932
6-[6-[3-[3-[4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-2-pyridinyl]phenanthridine (PubChem CID 176818932) has the molecular formula C50H32N6 and a molecular weight of 716.85 g/mol. Its IUPAC name is 6-[6-[3-[3-[4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-2-pyridinyl]phenanthridine.
| Compound Name | 6-[6-[3-[3-[4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-2-pyridinyl]phenanthridine |
|---|---|
| PubChem CID | 176818932 |
| Molecular Formula | C50H32N6 |
| Molecular Weight | 716.85 g/mol |
| Exact Mass | 716.27 |
| IUPAC Name | 6-[6-[3-[3-[4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-2-pyridinyl]phenanthridine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4cccnc4)cc3)nc(-c3cccc(-c4cccc(-c5cccc(-c6nc7ccccc7c7ccccc67)n5)c4)c3)n2)cc1 |
| InChI | InChI=1S/C50H32N6/c1-2-12-34(13-3-1)48-54-49(35-27-25-33(26-28-35)40-18-11-29-51-32-40)56-50(55-48)39-17-9-15-37(31-39)36-14-8-16-38(30-36)44-23-10-24-46(52-44)47-43-21-5-4-19-41(43)42-20-6-7-22-45(42)53-47/h1-32H |
| InChIKey | UAEPNPBQOYTNLE-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.85 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|