C32H23N3OS2 — CID 90296057
6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-(4-phenylthiophen-2-yl)-4-(5-phenylthiophen-2-yl)-[1,2,5]oxadiazolo[3,4-c]pyridine (PubChem CID 90296057) has the molecular formula C32H23N3OS2 and a molecular weight of 529.69 g/mol. Its IUPAC name is 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-(4-phenylthiophen-2-yl)-4-(5-phenylthiophen-2-yl)-[1,2,5]oxadiazolo[3,4-c]pyridine.
| Compound Name | 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-(4-phenylthiophen-2-yl)-4-(5-phenylthiophen-2-yl)-[1,2,5]oxadiazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 90296057 |
| Molecular Formula | C32H23N3OS2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-(4-phenylthiophen-2-yl)-4-(5-phenylthiophen-2-yl)-[1,2,5]oxadiazolo[3,4-c]pyridine |
| SMILES | C=C/C=C(\C=C/C)c1nc(-c2ccc(-c3ccccc3)s2)c2nonc2c1-c1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C32H23N3OS2/c1-3-11-23(12-4-2)29-28(27-19-24(20-37-27)21-13-7-5-8-14-21)31-32(35-36-34-31)30(33-29)26-18-17-25(38-26)22-15-9-6-10-16-22/h3-20H,1H2,2H3/b12-4-,23-11+ |
| InChIKey | XSCPHXMRGQNORQ-WJQAVCCZSA-N |
| XLogP | 9.55 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|