C17H25NO2S — CID 176689532
acetaldehyde;ethane;4-methyl-5-phenyl-2-propan-2-ylsulfanyl-1,3-oxazole (PubChem CID 176689532) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is acetaldehyde;ethane;4-methyl-5-phenyl-2-propan-2-ylsulfanyl-1,3-oxazole.
| Compound Name | acetaldehyde;ethane;4-methyl-5-phenyl-2-propan-2-ylsulfanyl-1,3-oxazole |
|---|---|
| PubChem CID | 176689532 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | acetaldehyde;ethane;4-methyl-5-phenyl-2-propan-2-ylsulfanyl-1,3-oxazole |
| SMILES | CC.CC=O.Cc1nc(SC(C)C)oc1-c1ccccc1 |
| InChI | InChI=1S/C13H15NOS.C2H4O.C2H6/c1-9(2)16-13-14-10(3)12(15-13)11-7-5-4-6-8-11;1-2-3;1-2/h4-9H,1-3H3;2H,1H3;1-2H3 |
| InChIKey | IWLZOJHHLXFCSL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|