C14H15NO2 — CID 174258977
4-(2-methylpropyl)-5-phenyl-1,3-oxazole-2-carbaldehyde (PubChem CID 174258977) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-(2-methylpropyl)-5-phenyl-1,3-oxazole-2-carbaldehyde.
| Compound Name | 4-(2-methylpropyl)-5-phenyl-1,3-oxazole-2-carbaldehyde |
|---|---|
| PubChem CID | 174258977 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-(2-methylpropyl)-5-phenyl-1,3-oxazole-2-carbaldehyde |
| SMILES | CC(C)Cc1nc(C=O)oc1-c1ccccc1 |
| InChI | InChI=1S/C14H15NO2/c1-10(2)8-12-14(17-13(9-16)15-12)11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | WQKLQWYUSBANCP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|