C8H11NO2 — CID 83815385
4-(2-methylpropyl)-1,3-oxazole-5-carbaldehyde (PubChem CID 83815385) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 4-(2-methylpropyl)-1,3-oxazole-5-carbaldehyde.
| Compound Name | 4-(2-methylpropyl)-1,3-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 83815385 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 4-(2-methylpropyl)-1,3-oxazole-5-carbaldehyde |
| SMILES | CC(C)Cc1ncoc1C=O |
| InChI | InChI=1S/C8H11NO2/c1-6(2)3-7-8(4-10)11-5-9-7/h4-6H,3H2,1-2H3 |
| InChIKey | LKHPSCTUGQSAEB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|