C8H11F2NO — CID 169163494
4-(2,2-difluoroethyl)-5-propan-2-yl-1,3-oxazole (PubChem CID 169163494) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-5-propan-2-yl-1,3-oxazole.
| Compound Name | 4-(2,2-difluoroethyl)-5-propan-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 169163494 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 4-(2,2-difluoroethyl)-5-propan-2-yl-1,3-oxazole |
| SMILES | CC(C)c1ocnc1CC(F)F |
| InChI | InChI=1S/C8H11F2NO/c1-5(2)8-6(3-7(9)10)11-4-12-8/h4-5,7H,3H2,1-2H3 |
| InChIKey | OPNWHRCWSSXAKC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |