C6H8FNO — CID 171831430
4-fluoro-5-propan-2-yl-1,3-oxazole (PubChem CID 171831430) has the molecular formula C6H8FNO and a molecular weight of 129.13 g/mol. Its IUPAC name is 4-fluoro-5-propan-2-yl-1,3-oxazole.
| Compound Name | 4-fluoro-5-propan-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 171831430 |
| Molecular Formula | C6H8FNO |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 4-fluoro-5-propan-2-yl-1,3-oxazole |
| SMILES | CC(C)c1ocnc1F |
| InChI | InChI=1S/C6H8FNO/c1-4(2)5-6(7)8-3-9-5/h3-4H,1-2H3 |
| InChIKey | FAXXEPZOSDFXEV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |