C10H13NO2 — CID 83816829
4-cyclohexyl-1,3-oxazole-5-carbaldehyde (PubChem CID 83816829) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-cyclohexyl-1,3-oxazole-5-carbaldehyde.
| Compound Name | 4-cyclohexyl-1,3-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 83816829 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-cyclohexyl-1,3-oxazole-5-carbaldehyde |
| SMILES | O=Cc1ocnc1C1CCCCC1 |
| InChI | InChI=1S/C10H13NO2/c12-6-9-10(11-7-13-9)8-4-2-1-3-5-8/h6-8H,1-5H2 |
| InChIKey | WZSMHHXDKVAOAO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|